What is the molecular formula of 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester?
The molecular formula is C15H22BFO3.
What are the synonyms for 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester?
The synonyms are 2-(2-Fluoro-3-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane and 2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
What is the molecular weight of 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester?
The molecular weight is 280.14 g/mol.
When was 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester created?
It was created on May 8, 2014.
When was 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester?
The IUPAC name is 2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
What is the InChI of 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester?
The InChI is InChI=1S/C15H22BFO3/c1-10(2)18-12-9-7-8-11(13(12)17)
What is the InChIKey of 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester?
The InChIKey is DSIBMZWYVMJDAZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OC(C)C)F.
What is the CAS number of 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester?
The CAS number is 1451391-00-6.
※ Please kindly note that our products are for research use only.