What is the molecular formula of 2-Fluoro-3-carboxyphenylboronic acid?
The molecular formula of 2-Fluoro-3-carboxyphenylboronic acid is C7H6BFO4.
What are the synonyms of 2-Fluoro-3-carboxyphenylboronic acid?
The synonyms of 2-Fluoro-3-carboxyphenylboronic acid are: a. 1072952-09-0 b. 3-borono-2-fluorobenzoic acid c. 3-CARBOXY-2-FLUOROPHENYLBORONIC ACID d. 2-Fluoro-3-carboxyphenylboronic acid e. 3-borono-2-fluoro-benzoic Acid
What is the molecular weight of 2-Fluoro-3-carboxyphenylboronic acid?
The molecular weight of 2-Fluoro-3-carboxyphenylboronic acid is 183.93 g/mol.
When was 2-Fluoro-3-carboxyphenylboronic acid created?
2-Fluoro-3-carboxyphenylboronic acid was created on September 14, 2005.
What is the IUPAC name of 2-Fluoro-3-carboxyphenylboronic acid?
The IUPAC name of 2-Fluoro-3-carboxyphenylboronic acid is 3-borono-2-fluorobenzoic acid.
What is the InChI of 2-Fluoro-3-carboxyphenylboronic acid?
The InChI of 2-Fluoro-3-carboxyphenylboronic acid is InChI=1S/C7H6BFO4/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3,12-13H,(H,10,11).
What is the InChIKey of 2-Fluoro-3-carboxyphenylboronic acid?
The InChIKey of 2-Fluoro-3-carboxyphenylboronic acid is DLSFOCMCMFDBOG-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-3-carboxyphenylboronic acid?
The canonical SMILES of 2-Fluoro-3-carboxyphenylboronic acid is B(C1=C(C(=CC=C1)C(=O)O)F)(O)O.
What is the CAS number of 2-Fluoro-3-carboxyphenylboronic acid?
The CAS number of 2-Fluoro-3-carboxyphenylboronic acid is 1072952-09-0.
What is the monoisotopic mass of 2-Fluoro-3-carboxyphenylboronic acid?
The monoisotopic mass of 2-Fluoro-3-carboxyphenylboronic acid is 184.0343170 g/mol.
※ Please kindly note that our products are for research use only.