What is the molecular formula of 2-Ethynylaniline?
The molecular formula of 2-Ethynylaniline is C8H7N.
What is the molecular weight of 2-Ethynylaniline?
The molecular weight of 2-Ethynylaniline is 117.15 g/mol.
What is the IUPAC Name of 2-Ethynylaniline?
The IUPAC Name of 2-Ethynylaniline is 2-ethynylaniline.
What is the InChI of 2-Ethynylaniline?
The InChI of 2-Ethynylaniline is InChI=1S/C8H7N/c1-2-7-5-3-4-6-8(7)9/h1,3-6H,9H2.
What is the InChIKey of 2-Ethynylaniline?
The InChIKey of 2-Ethynylaniline is ALQPJHSFIXARGX-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Ethynylaniline?
The canonical SMILES of 2-Ethynylaniline is C#CC1=CC=CC=C1N.
What is the CAS number of 2-Ethynylaniline?
The CAS number of 2-Ethynylaniline is 52670-38-9.
What is the EC number of 2-Ethynylaniline?
The EC number of 2-Ethynylaniline is 628-712-2.
What is the ChEMBL ID of 2-Ethynylaniline?
The ChEMBL ID of 2-Ethynylaniline is CHEMBL394629.
Is 2-Ethynylaniline a canonicalized compound?
Yes, 2-Ethynylaniline is a canonicalized compound.