What is the PubChem CID of 2-Ethylhexyl iodide?
PubChem CID: 102664
What is the molecular formula of 2-Ethylhexyl iodide?
Molecular Formula: C8H17I
What is the molecular weight of 2-Ethylhexyl iodide?
Molecular Weight: 240.12 g/mol
What is the IUPAC name of 2-Ethylhexyl iodide?
IUPAC Name: 3-(iodomethyl)heptane
What is the InChI of 2-Ethylhexyl iodide?
InChI: InChI=1S/C8H17I/c1-3-5-6-8(4-2)7-9/h8H,3-7H2,1-2H3
What is the InChIKey of 2-Ethylhexyl iodide?
InChIKey: WNPGSEJRPYSCDQ-UHFFFAOYSA-N
What is the canonical SMILES of 2-Ethylhexyl iodide?
Canonical SMILES: CCCCC(CC)CI
What is the CAS number of 2-Ethylhexyl iodide?
CAS Number: 1653-16-3
What is the EC number of 2-Ethylhexyl iodide?
EC Number: 216-720-5
Is 2-Ethylhexyl iodide a canonicalized compound?
Yes, the compound is canonicalized according to PubChem.