What is the PubChem CID of 2-Ethoxybenzhydrazide?
PubChem CID 140788.
What is the molecular formula of 2-Ethoxybenzhydrazide?
The molecular formula is C9H12N2O2.
What is the molecular weight of 2-Ethoxybenzhydrazide?
The molecular weight is 180.20 g/mol.
What is the IUPAC name of 2-Ethoxybenzhydrazide?
The IUPAC name is 2-ethoxybenzohydrazide.
What is the InChI of 2-Ethoxybenzhydrazide?
The InChI is InChI=1S/C9H12N2O2/c1-2-13-8-6-4-3-5-7(8)9(12)11-10/h3-6H,2,10H2,1H3,(H,11,12).
What is the InChIKey of 2-Ethoxybenzhydrazide?
The InChIKey is LADUENYEZHMRQH-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Ethoxybenzhydrazide?
The Canonical SMILES is CCOC1=CC=CC=C1C(=O)NN.
What is the CAS number of 2-Ethoxybenzhydrazide?
The CAS number is 21018-13-3.
What is the European Community (EC) Number of 2-Ethoxybenzhydrazide?
The European Community (EC) Number is 674-235-8.
Is 2-Ethoxybenzhydrazide a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.