What is the molecular formula of 2-Cyanoindole?
The molecular formula of 2-Cyanoindole is C9H6N2.
When was the PubChem CID for 2-Cyanoindole created and last modified?
The PubChem CID for 2-Cyanoindole was created on 2005-09-11 and last modified on 2023-12-30.
What is the IUPAC name of 2-Cyanoindole?
The IUPAC name of 2-Cyanoindole is 1H-indole-2-carbonitrile.
What is the InChIKey of 2-Cyanoindole?
The InChIKey of 2-Cyanoindole is CBTITARLOCZPDU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Cyanoindole?
The canonical SMILES of 2-Cyanoindole is C1=CC=C2C(=C1)C=C(N2)C#N.
What is the CAS number of 2-Cyanoindole?
The CAS number of 2-Cyanoindole is 36193-65-4.
What is the molecular weight of 2-Cyanoindole?
The molecular weight of 2-Cyanoindole is 142.16 g/mol.
What is the XLogP3 value of 2-Cyanoindole?
The XLogP3 value of 2-Cyanoindole is 2.5.
How many hydrogen bond donor counts does 2-Cyanoindole have?
2-Cyanoindole has 1 hydrogen bond donor count.
Is 2-Cyanoindole a canonicalized compound?
Yes, 2-Cyanoindole is a canonicalized compound according to PubChem.