What is the molecular formula of 2-Chloroheptane?
The molecular formula of 2-Chloroheptane is C7H15Cl.
What is the molecular weight of 2-Chloroheptane?
The molecular weight of 2-Chloroheptane is 134.65 g/mol.
What is the IUPAC name of 2-Chloroheptane?
The IUPAC name of 2-Chloroheptane is 2-chloroheptane.
What is the InChI of 2-Chloroheptane?
The InChI of 2-Chloroheptane is InChI=1S/C7H15Cl/c1-3-4-5-6-7(2)8/h7H,3-6H2,1-2H3.
What is the InChIKey of 2-Chloroheptane?
The InChIKey of 2-Chloroheptane is PTSLUOSUHFGQHV-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloroheptane?
The canonical SMILES of 2-Chloroheptane is CCCCCC(C)Cl.
What is the CAS number of 2-Chloroheptane?
The CAS number of 2-Chloroheptane is 1001-89-4.
What is the European Community (EC) number of 2-Chloroheptane?
The European Community (EC) number of 2-Chloroheptane is 213-683-7.
What is the XLogP3 value of 2-Chloroheptane?
The XLogP3 value of 2-Chloroheptane is 3.6.
Is 2-Chloroheptane a canonicalized compound?
Yes, 2-Chloroheptane is a canonicalized compound.