2-Chloro-6-fluoro-3-methoxybenzaldehyde

• Catalog Number: ACMA00001796
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 188.58
• Hazard Statements: H301-H315-H319-H335-H360D
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

The molecular formula of 2-Chloro-6-fluoro-3-methoxybenzaldehyde is C8H6ClFO2.

What is the molecular weight of 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

The molecular weight of 2-Chloro-6-fluoro-3-methoxybenzaldehyde is 188.58 g/mol.

What is the IUPAC name of 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

The IUPAC name of 2-Chloro-6-fluoro-3-methoxybenzaldehyde is 2-chloro-6-fluoro-3-methoxybenzaldehyde.

What is the InChI key of 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

The InChI key of 2-Chloro-6-fluoro-3-methoxybenzaldehyde is WRJUPJLEUPNEBO-UHFFFAOYSA-N.

What is the canonical SMILES notation for 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

The canonical SMILES notation for 2-Chloro-6-fluoro-3-methoxybenzaldehyde is COC1=C(C(=C(C=C1)F)C=O)Cl.

What is the XLogP3-AA value of 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

The XLogP3-AA value of 2-Chloro-6-fluoro-3-methoxybenzaldehyde is 2.1.

How many hydrogen bond acceptors are present in 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

There are 3 hydrogen bond acceptors present in 2-Chloro-6-fluoro-3-methoxybenzaldehyde.

What is the exact mass of 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

The exact mass of 2-Chloro-6-fluoro-3-methoxybenzaldehyde is 188.0040353 g/mol.

How many rotatable bonds are present in 2-Chloro-6-fluoro-3-methoxybenzaldehyde?

There are 2 rotatable bonds present in 2-Chloro-6-fluoro-3-methoxybenzaldehyde.

Is 2-Chloro-6-fluoro-3-methoxybenzaldehyde a canonicalized compound?

Yes, 2-Chloro-6-fluoro-3-methoxybenzaldehyde is a canonicalized compound.