What is the molecular formula of 2-Chloro-5-nitropyridine?
The molecular formula of 2-Chloro-5-nitropyridine is C5H3ClN2O2.
When was 2-Chloro-5-nitropyridine created?
2-Chloro-5-nitropyridine was created on March 26, 2005.
What is the IUPAC name of 2-Chloro-5-nitropyridine?
The IUPAC name of 2-Chloro-5-nitropyridine is 2-chloro-5-nitropyridine.
What is the InChI of 2-Chloro-5-nitropyridine?
The InChI of 2-Chloro-5-nitropyridine is InChI=1S/C5H3ClN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H.
What is the molecular weight of 2-Chloro-5-nitropyridine?
The molecular weight of 2-Chloro-5-nitropyridine is 158.54 g/mol.
What is the CAS number of 2-Chloro-5-nitropyridine?
The CAS number of 2-Chloro-5-nitropyridine is 4548-45-2.
What is the EC number of 2-Chloro-5-nitropyridine?
The EC number of 2-Chloro-5-nitropyridine is 224-908-3.
What is the DSSTox Substance ID of 2-Chloro-5-nitropyridine?
The DSSTox Substance ID of 2-Chloro-5-nitropyridine is DTXSID70196525.
What is the Nikkaji Number of 2-Chloro-5-nitropyridine?
The Nikkaji Number of 2-Chloro-5-nitropyridine is J31.395E.
Is 2-Chloro-5-nitropyridine a canonicalized compound?
Yes, 2-Chloro-5-nitropyridine is a canonicalized compound.