What is the molecular formula of 2-Chloro-3-methoxyphenol?
The molecular formula of 2-Chloro-3-methoxyphenol is C7H7ClO2.
What is the molecular weight of 2-Chloro-3-methoxyphenol?
The molecular weight of 2-Chloro-3-methoxyphenol is 158.58 g/mol.
What is the IUPAC name of 2-Chloro-3-methoxyphenol?
The IUPAC name of 2-Chloro-3-methoxyphenol is 2-chloro-3-methoxyphenol.
What is the InChI of 2-Chloro-3-methoxyphenol?
The InChI of 2-Chloro-3-methoxyphenol is InChI=1S/C7H7ClO2/c1-10-6-4-2-3-5(9)7(6)8/h2-4,9H,1H3.
What is the InChIKey of 2-Chloro-3-methoxyphenol?
The InChIKey of 2-Chloro-3-methoxyphenol is QGLVWTFUWVTDEQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-3-methoxyphenol?
The canonical SMILES of 2-Chloro-3-methoxyphenol is COC1=CC=CC(=C1Cl)O.
What is the CAS number of 2-Chloro-3-methoxyphenol?
The CAS number of 2-Chloro-3-methoxyphenol is 72232-49-6.
How many hydrogen bond donor counts are there in 2-Chloro-3-methoxyphenol?
There is one hydrogen bond donor count in 2-Chloro-3-methoxyphenol.
How many hydrogen bond acceptor counts are there in 2-Chloro-3-methoxyphenol?
There are two hydrogen bond acceptor counts in 2-Chloro-3-methoxyphenol.