What is the IUPAC name of the compound 2-Butylcyclohexanone?
The IUPAC name of the compound is 2-butylcyclohexan-1-one.
What is the molecular formula of 2-Butylcyclohexanone?
The molecular formula of 2-Butylcyclohexanone is C10H18O.
What is the molecular weight of 2-Butylcyclohexanone?
The molecular weight of 2-Butylcyclohexanone is 154.25 g/mol.
What is the CAS number of 2-Butylcyclohexanone?
The CAS number of 2-Butylcyclohexanone is 1126-18-7.
What is the InChI of 2-Butylcyclohexanone?
The InChI of 2-Butylcyclohexanone is InChI=1S/C10H18O/c1-2-3-6-9-7-4-5-8-10(9)11/h9H,2-8H2,1H3.
What is the InChIKey of 2-Butylcyclohexanone?
The InChIKey of 2-Butylcyclohexanone is POYYYXPQBFPUKS-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 2-Butylcyclohexanone have?
2-Butylcyclohexanone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Butylcyclohexanone have?
2-Butylcyclohexanone has 1 hydrogen bond acceptor count.
What is the topological polar surface area of 2-Butylcyclohexanone?
The topological polar surface area of 2-Butylcyclohexanone is 17.1 ?2.
How many rotatable bond counts does 2-Butylcyclohexanone have?
2-Butylcyclohexanone has 3 rotatable bond counts.