What is the molecular formula of 2-Butoxyaniline?
The molecular formula is C10H15NO.
What is the molecular weight of 2-Butoxyaniline?
The molecular weight is 165.23 g/mol.
What is the IUPAC name of 2-Butoxyaniline?
The IUPAC name is 2-butoxyaniline.
What is the InChI of 2-Butoxyaniline?
The InChI is InChI=1S/C10H15NO/c1-2-3-8-12-10-7-5-4-6-9(10)11/h4-7H,2-3,8,11H2,1H3.
What is the InChIKey of 2-Butoxyaniline?
The InChIKey is IRTONKUCLPTRNS-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Butoxyaniline?
The canonical SMILES is CCCCOC1=CC=CC=C1N.
What is the CAS number of 2-Butoxyaniline?
The CAS number is 4469-81-2.
What is the ChEMBL ID of 2-Butoxyaniline?
The ChEMBL ID is CHEMBL1741956.
What is the XLogP3 value of 2-Butoxyaniline?
The XLogP3 value is 2.4.
Is 2-Butoxyaniline a canonicalized compound?
Yes, 2-Butoxyaniline is a canonicalized compound.