What is the molecular formula of 2-Bromobenzyl alcohol?
The molecular formula is C7H7BrO.
What is the molecular weight of 2-Bromobenzyl alcohol?
The molecular weight is 187.03 g/mol.
What is the IUPAC name of 2-Bromobenzyl alcohol?
The IUPAC name is (2-bromophenyl)methanol.
What is the InChI of 2-Bromobenzyl alcohol?
The InChI is InChI=1S/C7H7BrO/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5H2.
What is the InChIKey of 2-Bromobenzyl alcohol?
The InChIKey is IOWGHQGLUMEZKG-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromobenzyl alcohol?
The canonical SMILES is C1=CC=C(C(=C1)CO)Br.
What is the CAS number of 2-Bromobenzyl alcohol?
The CAS number is 18982-54-2.
What is the European Community (EC) number of 2-Bromobenzyl alcohol?
The European Community (EC) number is 242-719-4.
What is the UNII number of 2-Bromobenzyl alcohol?
The UNII number is XH9B68J1KG.
Is 2-Bromobenzyl alcohol a canonicalized compound?
Yes, 2-Bromobenzyl alcohol is canonicalized.