What is the molecular formula of 2-Bromobenzamide?
The molecular formula of 2-Bromobenzamide is C7H6BrNO.
What is the molecular weight of 2-Bromobenzamide?
The molecular weight of 2-Bromobenzamide is 200.03 g/mol.
What is the IUPAC name of 2-Bromobenzamide?
The IUPAC name of 2-Bromobenzamide is 2-bromobenzamide.
What is the InChI of 2-Bromobenzamide?
The InChI of 2-Bromobenzamide is InChI=1S/C7H6BrNO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10).
What is the InChIKey of 2-Bromobenzamide?
The InChIKey of 2-Bromobenzamide is NHNAEZDWNCRWRW-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromobenzamide?
The canonical SMILES of 2-Bromobenzamide is C1=CC=C(C(=C1)C(=O)N)Br.
What is the CAS number of 2-Bromobenzamide?
The CAS number of 2-Bromobenzamide is 4001-73-4.
What is the European Community (EC) Number of 2-Bromobenzamide?
The European Community (EC) Number of 2-Bromobenzamide is 223-650-9.
What is the UNII of 2-Bromobenzamide?
The UNII of 2-Bromobenzamide is 84VHS7LS88.
Is 2-Bromobenzamide a canonicalized compound?
Yes, 2-Bromobenzamide is a canonicalized compound.