What is the molecular formula of 2-Bromo nicotinamide?
The molecular formula of 2-Bromo nicotinamide is C6H5BrN2O.
What is the molecular weight of 2-Bromo nicotinamide?
The molecular weight of 2-Bromo nicotinamide is 201.02 g/mol.
What is the IUPAC name of 2-Bromo nicotinamide?
The IUPAC name of 2-Bromo nicotinamide is 2-bromopyridine-3-carboxamide.
What is the InChI of 2-Bromo nicotinamide?
The InChI of 2-Bromo nicotinamide is InChI=1S/C6H5BrN2O/c7-5-4(6(8)10)2-1-3-9-5/h1-3H,(H2,8,10).
What is the InChIKey of 2-Bromo nicotinamide?
The InChIKey of 2-Bromo nicotinamide is IHOOHSQJKUMHIG-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo nicotinamide?
The canonical SMILES of 2-Bromo nicotinamide is C1=CC(=C(N=C1)Br)C(=O)N.
What is the CAS number of 2-Bromo nicotinamide?
The CAS number of 2-Bromo nicotinamide is 87674-18-8.
What is the XLogP3 value of 2-Bromo nicotinamide?
The XLogP3 value of 2-Bromo nicotinamide is 1.7.
How many hydrogen bond donor counts does 2-Bromo nicotinamide have?
2-Bromo nicotinamide has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Bromo nicotinamide have?
2-Bromo nicotinamide has 2 hydrogen bond acceptor counts.