The molecular formula of the compound is C10H12BrNO.
What are the synonyms for the compound?
The synonyms for the compound are 2-bromo-N-(2,6-dimethylphenyl)acetamide, 32433-61-7, 40251-98-7, Acetamide, 2-bromo-N-(2,6-dimethylphenyl)-, N-(2,6-dimethylphenyl)-2-bromoacetamide.
What is the molecular weight of the compound?
The molecular weight of the compound is 242.11 g/mol.
When was the compound created and modified?
The compound was created on July 19, 2005, and last modified on November 25, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-bromo-N-(2,6-dimethylphenyl)acetamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H12BrNO/c1-7-4-3-5-8(2)10(7)12-9(13)6-11/h3-5H,6H2,1-2H3,(H,12,13).
What is the InChIKey of the compound?
The InChIKey of the compound is FMQPTEFSATTZFW-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=C(C(=CC=C1)C)NC(=O)CBr.
What is the CAS number of the compound?
The CAS number of the compound is 40251-98-7.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.