What is the molecular formula of 2-Bromo-6-methylaniline?
The molecular formula of 2-Bromo-6-methylaniline is C7H8BrN.
What is the molecular weight of 2-Bromo-6-methylaniline?
The molecular weight of 2-Bromo-6-methylaniline is 186.05 g/mol.
What is the IUPAC Name of 2-Bromo-6-methylaniline?
The IUPAC Name of 2-Bromo-6-methylaniline is 2-bromo-6-methylaniline.
What is the InChI of 2-Bromo-6-methylaniline?
The InChI of 2-Bromo-6-methylaniline is InChI=1S/C7H8BrN/c1-5-3-2-4-6(8)7(5)9/h2-4H,9H2,1H3.
What is the InChIKey of 2-Bromo-6-methylaniline?
The InChIKey of 2-Bromo-6-methylaniline is LDUCMSVRKKDATH-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromo-6-methylaniline?
The Canonical SMILES of 2-Bromo-6-methylaniline is CC1=C(C(=CC=C1)Br)N.
What is the CAS number of 2-Bromo-6-methylaniline?
The CAS number of 2-Bromo-6-methylaniline is 53848-17-2.
What is the EC Number of 2-Bromo-6-methylaniline?
The EC Number of 2-Bromo-6-methylaniline is 626-502-5.
Is 2-Bromo-6-methylaniline a canonicalized compound?
Yes, 2-Bromo-6-methylaniline is a canonicalized compound.