What is the molecular formula of 2-Bromo-6-chlorotoluene?
The molecular formula of 2-Bromo-6-chlorotoluene is C7H6BrCl.
What is the molecular weight of 2-Bromo-6-chlorotoluene?
The molecular weight of 2-Bromo-6-chlorotoluene is 205.48 g/mol.
What is the IUPAC name of 2-Bromo-6-chlorotoluene?
The IUPAC name of 2-Bromo-6-chlorotoluene is 1-bromo-3-chloro-2-methylbenzene.
What is the InChI of 2-Bromo-6-chlorotoluene?
The InChI of 2-Bromo-6-chlorotoluene is InChI=1S/C7H6BrCl/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3.
What is the InChIKey of 2-Bromo-6-chlorotoluene?
The InChIKey of 2-Bromo-6-chlorotoluene is DMARBQGIQKLIPM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-6-chlorotoluene?
The canonical SMILES of 2-Bromo-6-chlorotoluene is CC1=C(C=CC=C1Br)Cl.
What is the CAS number of 2-Bromo-6-chlorotoluene?
The CAS number of 2-Bromo-6-chlorotoluene is 62356-27-8.
What is the EC number of 2-Bromo-6-chlorotoluene?
The EC number of 2-Bromo-6-chlorotoluene is 263-520-9.
What is the molecular weight of 2-Bromo-6-chlorotoluene according to PubChem?
The molecular weight of 2-Bromo-6-chlorotoluene is 205.48 g/mol according to PubChem.
Is 2-Bromo-6-chlorotoluene a canonicalized compound?
Yes, 2-Bromo-6-chlorotoluene is a canonicalized compound according to PubChem.