CAS
959997-88-7 Purity
---
959997-88-7 Purity
---
Inquiry Basket
2-Bromo-5-trifluoromethoxyphenylboronic acid
CAS
957034-55-8
Catalog Number
ACM957034558-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-5-trifluoromethoxyphenylboronic acid?
The molecular formula of 2-Bromo-5-trifluoromethoxyphenylboronic acid is C7H5BBrF3O3.
What is the molecular weight of 2-Bromo-5-trifluoromethoxyphenylboronic acid?
The molecular weight of 2-Bromo-5-trifluoromethoxyphenylboronic acid is 284.82 g/mol.
What is the IUPAC name of 2-Bromo-5-trifluoromethoxyphenylboronic acid?
The IUPAC name of 2-Bromo-5-trifluoromethoxyphenylboronic acid is [2-bromo-5-(trifluoromethoxy)phenyl]boronic acid.
What is the InChI of 2-Bromo-5-trifluoromethoxyphenylboronic acid?
The InChI of 2-Bromo-5-trifluoromethoxyphenylboronic acid is InChI=1S/C7H5BBrF3O3/c9-6-2-1-4(15-7(10,11)12)3-5(6)8(13)14/h1-3,13-14H.
What is the InChIKey of 2-Bromo-5-trifluoromethoxyphenylboronic acid?
The InChIKey of 2-Bromo-5-trifluoromethoxyphenylboronic acid is QSBIMKBCXNIDTI-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-trifluoromethoxyphenylboronic acid?
The canonical SMILES of 2-Bromo-5-trifluoromethoxyphenylboronic acid is B(C1=C(C=CC(=C1)OC(F)(F)F)Br)(O)O.
What is the CAS number of 2-Bromo-5-trifluoromethoxyphenylboronic acid?
The CAS number of 2-Bromo-5-trifluoromethoxyphenylboronic acid is 957034-55-8.
How many hydrogen bond donor counts does 2-Bromo-5-trifluoromethoxyphenylboronic acid have?
2-Bromo-5-trifluoromethoxyphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Bromo-5-trifluoromethoxyphenylboronic acid have?
2-Bromo-5-trifluoromethoxyphenylboronic acid has 6 hydrogen bond acceptor counts.
Recommended Products
