What is the molecular formula of 2-Bromo-5-formylthiazole?
The molecular formula of 2-Bromo-5-formylthiazole is C4H2BrNOS.
What is the molecular weight of 2-Bromo-5-formylthiazole?
The molecular weight of 2-Bromo-5-formylthiazole is 192.04 g/mol.
What is the IUPAC name of 2-Bromo-5-formylthiazole?
The IUPAC name of 2-Bromo-5-formylthiazole is 2-bromo-1,3-thiazole-5-carbaldehyde.
What is the InChI of 2-Bromo-5-formylthiazole?
The InChI of 2-Bromo-5-formylthiazole is InChI=1S/C4H2BrNOS/c5-4-6-1-3(2-7)8-4/h1-2H.
What is the InChIKey of 2-Bromo-5-formylthiazole?
The InChIKey of 2-Bromo-5-formylthiazole is DJUWIZUEHXRECB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-formylthiazole?
The canonical SMILES of 2-Bromo-5-formylthiazole is C1=C(SC(=N1)Br)C=O.
What is the CAS number of 2-Bromo-5-formylthiazole?
The CAS number of 2-Bromo-5-formylthiazole is 464192-28-7.
What is the European Community (EC) number of 2-Bromo-5-formylthiazole?
The European Community (EC) number of 2-Bromo-5-formylthiazole is 670-319-3.
What is the Nikkaji Number of 2-Bromo-5-formylthiazole?
The Nikkaji Number of 2-Bromo-5-formylthiazole is J3.503.007G.
Is 2-Bromo-5-formylthiazole a canonicalized compound?
Yes, 2-Bromo-5-formylthiazole is a canonicalized compound.