What is the molecular formula of 2-Bromo-5-chlorotoluene?
The molecular formula of 2-Bromo-5-chlorotoluene is C7H6BrCl.
What is the molecular weight of 2-Bromo-5-chlorotoluene?
The molecular weight of 2-Bromo-5-chlorotoluene is 205.48 g/mol.
What is the IUPAC name of 2-Bromo-5-chlorotoluene?
The IUPAC name of 2-Bromo-5-chlorotoluene is 1-bromo-4-chloro-2-methylbenzene.
What is the InChI of 2-Bromo-5-chlorotoluene?
The InChI of 2-Bromo-5-chlorotoluene is InChI=1S/C7H6BrCl/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3.
What is the InChIKey of 2-Bromo-5-chlorotoluene?
The InChIKey of 2-Bromo-5-chlorotoluene is RTIPTGMVQIIMKL-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-chlorotoluene?
The canonical SMILES of 2-Bromo-5-chlorotoluene is CC1=C(C=CC(=C1)Cl)Br.
What is the CAS number of 2-Bromo-5-chlorotoluene?
The CAS number of 2-Bromo-5-chlorotoluene is 14495-51-3.
What is the European Community (EC) number of 2-Bromo-5-chlorotoluene?
The European Community (EC) number of 2-Bromo-5-chlorotoluene is 238-503-4.
What is the UNII of 2-Bromo-5-chlorotoluene?
The UNII of 2-Bromo-5-chlorotoluene is SKU92X9K9G.
What is the molecular weight of 2-Bromo-5-chlorotoluene according to PubChem?
The molecular weight of 2-Bromo-5-chlorotoluene is 205.48 g/mol, computed by PubChem 2.1.