What is the molecular formula of 2-Bromo-4-methoxyphenol?
The molecular formula of 2-Bromo-4-methoxyphenol is C7H7BrO2.
What are the synonyms of 2-Bromo-4-methoxyphenol?
The synonyms of 2-Bromo-4-methoxyphenol include 2-Bromo-4-methoxybenzenol, Phenol, 2-bromo-4-methoxy-, and 3-Bromo-4-hydroxyanisole.
What is the molecular weight of 2-Bromo-4-methoxyphenol?
The molecular weight of 2-Bromo-4-methoxyphenol is 203.03 g/mol.
What is the IUPAC Name of 2-Bromo-4-methoxyphenol?
The IUPAC Name of 2-Bromo-4-methoxyphenol is 2-bromo-4-methoxyphenol.
What is the InChI of 2-Bromo-4-methoxyphenol?
The InChI of 2-Bromo-4-methoxyphenol is InChI=1S/C7H7BrO2/c1-10-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3.
What is the InChIKey of 2-Bromo-4-methoxyphenol?
The InChIKey of 2-Bromo-4-methoxyphenol is LTMSUXSPKZRMAB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-methoxyphenol?
The canonical SMILES of 2-Bromo-4-methoxyphenol is COC1=CC(=C(C=C1)O)Br.
What is the CAS number of 2-Bromo-4-methoxyphenol?
The CAS number of 2-Bromo-4-methoxyphenol is 17332-11-5.
Is 2-Bromo-4-methoxyphenol a canonicalized compound?
Yes, 2-Bromo-4-methoxyphenol is a canonicalized compound.