What is the molecular formula of 2-bromo-3-nitrotoluene?
The molecular formula of 2-bromo-3-nitrotoluene is C7H6BrNO2.
What is the molecular weight of 2-bromo-3-nitrotoluene?
The molecular weight of 2-bromo-3-nitrotoluene is 216.03 g/mol.
What is the IUPAC name of 2-bromo-3-nitrotoluene?
The IUPAC name of 2-bromo-3-nitrotoluene is 2-bromo-1-methyl-3-nitrobenzene.
What is the InChI of 2-bromo-3-nitrotoluene?
The InChI of 2-bromo-3-nitrotoluene is InChI=1S/C7H6BrNO2/c1-5-3-2-4-6(7(5)8)9(10)11/h2-4H,1H3.
What is the InChIKey of 2-bromo-3-nitrotoluene?
The InChIKey of 2-bromo-3-nitrotoluene is GCAAVRIWNMTOKB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-bromo-3-nitrotoluene?
The canonical SMILES of 2-bromo-3-nitrotoluene is CC1=C(C(=CC=C1)[N+](=O)[O-])Br.
What is the CAS number of 2-bromo-3-nitrotoluene?
The CAS number of 2-bromo-3-nitrotoluene is 41085-43-2.
What is the EC number of 2-bromo-3-nitrotoluene?
The EC number of 2-bromo-3-nitrotoluene is 628-326-4.
What is the DSSTox Substance ID of 2-bromo-3-nitrotoluene?
The DSSTox Substance ID of 2-bromo-3-nitrotoluene is DTXSID30282877.
Is 2-bromo-3-nitrotoluene a canonicalized compound?
Yes, 2-bromo-3-nitrotoluene is a canonicalized compound according to PubChem.