What is the molecular formula of 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester?
The molecular formula is C12H17BBrNO2.
What are the synonyms of 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester?
The synonyms include 1256360-64-1, 2-Bromo-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 6-Bromo-5-methylpyridine-3-boronic acid pinacol ester, and more.
What is the molecular weight of 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester?
The molecular weight is 297.99 g/mol.
When was 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester created?
It was created on July 26, 2010.
When was 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester?
The IUPAC name is 2-bromo-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI of 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester?
The InChI is InChI=1S/C12H17BBrNO2/c1-8-6-9(7-15-10(8)14)13-16-11(2,3)12(4,5)17-13/h6-7H,1-5H3.
What is the InChIKey of 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester?
The InChIKey is QDYURULIZKUCKL-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Br)C.
What is the CAS number of 2-Bromo-3-methylpyridine-5-boronic acid pinacol ester?
The CAS number is 1256360-64-1.
※ Please kindly note that our products are for research use only.