What is the molecular formula of 2-Bromo-3-fluorobenzoic acid methyl ester?
The molecular formula of 2-Bromo-3-fluorobenzoic acid methyl ester is C8H6BrFO2.
What are the synonyms of 2-Bromo-3-fluorobenzoic acid methyl ester?
The synonyms of 2-Bromo-3-fluorobenzoic acid methyl ester are Methyl 2-bromo-3-fluorobenzoate, Benzoic acid, 2-bromo-3-fluoro-, methyl ester, and MFCD10000921.
What is the molecular weight of 2-Bromo-3-fluorobenzoic acid methyl ester?
The molecular weight of 2-Bromo-3-fluorobenzoic acid methyl ester is 233.03 g/mol.
What is the IUPAC name of 2-Bromo-3-fluorobenzoic acid methyl ester?
The IUPAC name of 2-Bromo-3-fluorobenzoic acid methyl ester is methyl 2-bromo-3-fluorobenzoate.
What is the InChI of 2-Bromo-3-fluorobenzoic acid methyl ester?
The InChI of 2-Bromo-3-fluorobenzoic acid methyl ester is InChI=1S/C8H6BrFO2/c1-12-8(11)5-3-2-4-6(10)7(5)9/h2-4H,1H3.
What is the InChIKey of 2-Bromo-3-fluorobenzoic acid methyl ester?
The InChIKey of 2-Bromo-3-fluorobenzoic acid methyl ester is UDCCTNIBELHUQN-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-fluorobenzoic acid methyl ester?
The canonical SMILES of 2-Bromo-3-fluorobenzoic acid methyl ester is COC(=O)C1=C(C(=CC=C1)F)Br.
How many hydrogen bond donor counts does 2-Bromo-3-fluorobenzoic acid methyl ester have?
2-Bromo-3-fluorobenzoic acid methyl ester has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Bromo-3-fluorobenzoic acid methyl ester have?
2-Bromo-3-fluorobenzoic acid methyl ester has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Bromo-3-fluorobenzoic acid methyl ester have?
2-Bromo-3-fluorobenzoic acid methyl ester has 2 rotatable bond counts.
※ Please kindly note that our products are for research use only.