What is the molecular formula of 2-Bromo-3-chlorotoluene?
The molecular formula is C7H6BrCl.
What is the molecular weight of 2-Bromo-3-chlorotoluene?
The molecular weight is 205.48 g/mol.
What is the IUPAC name of 2-Bromo-3-chlorotoluene?
The IUPAC name is 2-bromo-1-chloro-3-methylbenzene.
What is the InChI of 2-Bromo-3-chlorotoluene?
The InChI is InChI=1S/C7H6BrCl/c1-5-3-2-4-6(9)7(5)8/h2-4H,1H3.
What is the InChIKey of 2-Bromo-3-chlorotoluene?
The InChIKey is ADSIBTDRKLGGEO-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-chlorotoluene?
The canonical SMILES is CC1=C(C(=CC=C1)Cl)Br.
What is the CAS number of 2-Bromo-3-chlorotoluene?
The CAS number is 69190-56-3.
What is the EC number of 2-Bromo-3-chlorotoluene?
The EC number is 641-162-8.
Is 2-Bromo-3-chlorotoluene a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.