What is the molecular formula of 2-bromo-3-chloropyrazine?
The molecular formula of 2-bromo-3-chloropyrazine is C4H2BrClN2.
What is the molecular weight of 2-bromo-3-chloropyrazine?
The molecular weight of 2-bromo-3-chloropyrazine is 193.43 g/mol.
What is the IUPAC name of 2-bromo-3-chloropyrazine?
The IUPAC name of 2-bromo-3-chloropyrazine is 2-bromo-3-chloropyrazine.
What is the InChI of 2-bromo-3-chloropyrazine?
The InChI of 2-bromo-3-chloropyrazine is InChI=1S/C4H2BrClN2/c5-3-4(6)8-2-1-7-3/h1-2H.
What is the InChIKey of 2-bromo-3-chloropyrazine?
The InChIKey of 2-bromo-3-chloropyrazine is OTZUKTGQTUYRCH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-bromo-3-chloropyrazine?
The canonical SMILES of 2-bromo-3-chloropyrazine is C1=CN=C(C(=N1)Cl)Br.
What is the CAS number of 2-bromo-3-chloropyrazine?
The CAS number of 2-bromo-3-chloropyrazine is 1206250-01-2.
What is the EC number of 2-bromo-3-chloropyrazine?
The EC number of 2-bromo-3-chloropyrazine is 827-462-3.
What is the hydrogen bond donor count of 2-bromo-3-chloropyrazine?
The hydrogen bond donor count of 2-bromo-3-chloropyrazine is 0.
What is the hydrogen bond acceptor count of 2-bromo-3-chloropyrazine?
The hydrogen bond acceptor count of 2-bromo-3-chloropyrazine is 2.