CAS
7745-93-9 Purity
98%
7745-93-9 Purity
98%
Shopping basket
2-Bromo-1-chloro-4-methylbenzene
CAS
57310-39-1
Catalog Number
ACM57310391
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-1-chloro-4-methylbenzene?
The molecular formula of 2-Bromo-1-chloro-4-methylbenzene is C7H6BrCl.
What is the molecular weight of 2-Bromo-1-chloro-4-methylbenzene?
The molecular weight of 2-Bromo-1-chloro-4-methylbenzene is 205.48 g/mol.
What is the IUPAC name of 2-Bromo-1-chloro-4-methylbenzene?
The IUPAC name of 2-Bromo-1-chloro-4-methylbenzene is 2-bromo-1-chloro-4-methylbenzene.
What is the InChI of 2-Bromo-1-chloro-4-methylbenzene?
The InChI of 2-Bromo-1-chloro-4-methylbenzene is InChI=1S/C7H6BrCl/c1-5-2-3-7(9)6(8)4-5/h2-4H,1H3.
What is the InChIKey of 2-Bromo-1-chloro-4-methylbenzene?
The InChIKey of 2-Bromo-1-chloro-4-methylbenzene is UWXPTVKKHVOZLJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-1-chloro-4-methylbenzene?
The canonical SMILES of 2-Bromo-1-chloro-4-methylbenzene is CC1=CC(=C(C=C1)Cl)Br.
What is the CAS number of 2-Bromo-1-chloro-4-methylbenzene?
The CAS number of 2-Bromo-1-chloro-4-methylbenzene is 57310-39-1.
What is the XLogP3-AA value of 2-Bromo-1-chloro-4-methylbenzene?
The XLogP3-AA value of 2-Bromo-1-chloro-4-methylbenzene is 3.6.
How many hydrogen bond donor counts does 2-Bromo-1-chloro-4-methylbenzene have?
2-Bromo-1-chloro-4-methylbenzene has 0 hydrogen bond donor count.
How many rotatable bond counts does 2-Bromo-1-chloro-4-methylbenzene have?
2-Bromo-1-chloro-4-methylbenzene has 0 rotatable bond count.
Recommended Products
