What is the PubChem CID of 2-(Boc-amino)pyrimidine-5-boronic acid?
The PubChem CID of 2-(Boc-amino)pyrimidine-5-boronic acid is 45489688.
What is the molecular formula of 2-(Boc-amino)pyrimidine-5-boronic acid?
The molecular formula of 2-(Boc-amino)pyrimidine-5-boronic acid is C9H14BN3O4.
What is the molecular weight of 2-(Boc-amino)pyrimidine-5-boronic acid?
The molecular weight of 2-(Boc-amino)pyrimidine-5-boronic acid is 239.04 g/mol.
What is the IUPAC name of 2-(Boc-amino)pyrimidine-5-boronic acid?
The IUPAC name of 2-(Boc-amino)pyrimidine-5-boronic acid is [2-[(2-methylpropan-2-yl)oxycarbonylamino]pyrimidin-5-yl]boronic acid.
What is the InChI of 2-(Boc-amino)pyrimidine-5-boronic acid?
The InChI of 2-(Boc-amino)pyrimidine-5-boronic acid is InChI=1S/C9H14BN3O4/c1-9(2,3)17-8(14)13-7-11-4-6(5-12-7)10(15)16/h4-5,15-16H,1-3H3,(H,11,12,13,14).
What is the InChIKey of 2-(Boc-amino)pyrimidine-5-boronic acid?
The InChIKey of 2-(Boc-amino)pyrimidine-5-boronic acid is IOLSSXXMDVLBHF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(Boc-amino)pyrimidine-5-boronic acid?
The canonical SMILES of 2-(Boc-amino)pyrimidine-5-boronic acid is B(C1=CN=C(N=C1)NC(=O)OC(C)(C)C)(O)O.
What is the CAS number of 2-(Boc-amino)pyrimidine-5-boronic acid?
The CAS number of 2-(Boc-amino)pyrimidine-5-boronic acid is 883231-25-2.
What is the hydrogen bond donor count of 2-(Boc-amino)pyrimidine-5-boronic acid?
The hydrogen bond donor count of 2-(Boc-amino)pyrimidine-5-boronic acid is 3.
What is the hydrogen bond acceptor count of 2-(Boc-amino)pyrimidine-5-boronic acid?
The hydrogen bond acceptor count of 2-(Boc-amino)pyrimidine-5-boronic acid is 6.
※ Please kindly note that our products are for research use only.