What is the PubChem CID of 2-Biphenylboronic acid?
The PubChem CID of 2-Biphenylboronic acid is 4589187.
What is the molecular formula of 2-Biphenylboronic acid?
The molecular formula of 2-Biphenylboronic acid is C12H11BO2.
What is the molecular weight of 2-Biphenylboronic acid?
The molecular weight of 2-Biphenylboronic acid is 198.03 g/mol.
What is the IUPAC name of 2-Biphenylboronic acid?
The IUPAC name of 2-Biphenylboronic acid is (2-phenylphenyl)boronic acid.
What is the InChI of 2-Biphenylboronic acid?
The InChI of 2-Biphenylboronic acid is InChI=1S/C12H11BO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,14-15H.
What is the InChIKey of 2-Biphenylboronic acid?
The InChIKey of 2-Biphenylboronic acid is HYCYKHYFIWHGEX-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Biphenylboronic acid?
The canonical SMILES of 2-Biphenylboronic acid is B(C1=CC=CC=C1C2=CC=CC=C2)(O)O.
What is the CAS number of 2-Biphenylboronic acid?
The CAS number of 2-Biphenylboronic acid is 4688-76-0.
What is the DSSTox Substance ID of 2-Biphenylboronic acid?
The DSSTox Substance ID of 2-Biphenylboronic acid is DTXSID20404607.
Is 2-Biphenylboronic acid a canonicalized compound?
Yes, 2-Biphenylboronic acid is a canonicalized compound according to PubChem.