What is the molecular formula of 2-Benzoylpyrrole?
The molecular formula of 2-Benzoylpyrrole is C11H9NO.
What is the molecular weight of 2-Benzoylpyrrole?
The molecular weight of 2-Benzoylpyrrole is 171.19 g/mol.
How is the IUPAC name of 2-Benzoylpyrrole computed?
The IUPAC name of 2-Benzoylpyrrole is computed by Lexichem TK 2.7.0.
What is the InChIKey of 2-Benzoylpyrrole?
The InChIKey of 2-Benzoylpyrrole is NFGGQMYSOLVBLF-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Benzoylpyrrole?
The canonical SMILES representation of 2-Benzoylpyrrole is C1=CC=C(C=C1)C(=O)C2=CC=CN2.
What is the CAS number of 2-Benzoylpyrrole?
The CAS number of 2-Benzoylpyrrole is 7697-46-3.
What is the XLogP3 value of 2-Benzoylpyrrole?
The XLogP3 value of 2-Benzoylpyrrole is 2.6.
How many hydrogen bond donor counts does 2-Benzoylpyrrole have?
2-Benzoylpyrrole has 1 hydrogen bond donor count.
How many rotatable bond counts does 2-Benzoylpyrrole have?
2-Benzoylpyrrole has 2 rotatable bond counts.
Is the compound canonicalized for 2-Benzoylpyrrole?
Yes, the compound is canonicalized for 2-Benzoylpyrrole.