What is the molecular formula of (2-Aminomethyl-benzyl)-diethyl-amine?
The molecular formula is C12H20N2.
What are the synonyms for (2-Aminomethyl-benzyl)-diethyl-amine?
The synonyms are 84227-68-9, 1,2-Benzenedimethanamine, N1,N1-diethyl-{2-[(diethylamino)methyl]phenyl}methanamine, and N-[[2-(aminomethyl)phenyl]methyl]-N-ethylethanamine.
What is the molecular weight of (2-Aminomethyl-benzyl)-diethyl-amine?
The molecular weight is 192.30 g/mol.
What is the IUPAC name of (2-Aminomethyl-benzyl)-diethyl-amine?
The IUPAC name is N-[[2-(aminomethyl)phenyl]methyl]-N-ethylethanamine.
What is the InChI code of (2-Aminomethyl-benzyl)-diethyl-amine?
The InChI code is InChI=1S/C12H20N2/c1-3-14(4-2)10-12-8-6-5-7-11(12)9-13/h5-8H,3-4,9-10,13H2,1-2H3.
What is the InChIKey of (2-Aminomethyl-benzyl)-diethyl-amine?
The InChIKey is CVVJKBIPNSXFSQ-UHFFFAOYSA-N.
What is the canonical SMILES of (2-Aminomethyl-benzyl)-diethyl-amine?
The canonical SMILES is CCN(CC)CC1=CC=CC=C1CN.
What is the CAS number of (2-Aminomethyl-benzyl)-diethyl-amine?
The CAS number is 84227-68-9.
What is the XLogP3-AA value of (2-Aminomethyl-benzyl)-diethyl-amine?
The XLogP3-AA value is 1.3.
Is (2-Aminomethyl-benzyl)-diethyl-amine a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.