What is the molecular formula of 2-Aminoindan-1-ol?
The molecular formula of 2-Aminoindan-1-ol is C9H11NO.
What is the molecular weight of 2-Aminoindan-1-ol?
The molecular weight of 2-Aminoindan-1-ol is 149.19 g/mol.
What is the IUPAC name of 2-Aminoindan-1-ol?
The IUPAC name of 2-Aminoindan-1-ol is 2-amino-2,3-dihydro-1H-inden-1-ol.
What is the InChI of 2-Aminoindan-1-ol?
The InChI of 2-Aminoindan-1-ol is InChI=1S/C9H11NO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5,10H2.
What is the InChIKey of 2-Aminoindan-1-ol?
The InChIKey of 2-Aminoindan-1-ol is HRWCWYGWEVVDLT-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Aminoindan-1-ol?
The Canonical SMILES of 2-Aminoindan-1-ol is C1C(C(C2=CC=CC=C21)O)N.
What is the CAS number of 2-Aminoindan-1-ol?
The CAS number of 2-Aminoindan-1-ol is 15028-16-7.
What is the XLogP3 value of 2-Aminoindan-1-ol?
The XLogP3 value of 2-Aminoindan-1-ol is 0.5.
How many hydrogen bond donor counts does 2-Aminoindan-1-ol have?
2-Aminoindan-1-ol has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Aminoindan-1-ol have?
2-Aminoindan-1-ol has 2 hydrogen bond acceptor counts.