What is the molecular formula of 2-Aminocyclohexanol?
The molecular formula of 2-Aminocyclohexanol is C6H13NO.
What is the molecular weight of 2-Aminocyclohexanol?
The molecular weight of 2-Aminocyclohexanol is 115.17 g/mol.
What is the IUPAC name of 2-Aminocyclohexanol?
The IUPAC name of 2-Aminocyclohexanol is 2-aminocyclohexan-1-ol.
What is the InChI of 2-Aminocyclohexanol?
The InChI of 2-Aminocyclohexanol is InChI=1S/C6H13NO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4,7H2.
What is the InChIKey of 2-Aminocyclohexanol?
The InChIKey of 2-Aminocyclohexanol is PQMCFTMVQORYJC-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Aminocyclohexanol?
The canonical SMILES of 2-Aminocyclohexanol is C1CCC(C(C1)N)O.
What is the CAS number of 2-Aminocyclohexanol?
The CAS number of 2-Aminocyclohexanol is 931-15-7.
What is the European Community (EC) number of 2-Aminocyclohexanol?
The European Community (EC) number of 2-Aminocyclohexanol is 640-699-5.
What is the XLogP3-AA value of 2-Aminocyclohexanol?
The XLogP3-AA value of 2-Aminocyclohexanol is -0.1.
Is 2-Aminocyclohexanol a canonicalized compound?
Yes, 2-Aminocyclohexanol is a canonicalized compound.