What is the molecular formula of 2-Aminobicyclohexyl?
The molecular formula of 2-Aminobicyclohexyl is C12H23N.
What is the molecular weight of 2-Aminobicyclohexyl?
The molecular weight of 2-Aminobicyclohexyl is 181.32 g/mol.
What is the IUPAC name of 2-Aminobicyclohexyl?
The IUPAC name of 2-Aminobicyclohexyl is 2-cyclohexylcyclohexan-1-amine.
What is the InChI of 2-Aminobicyclohexyl?
The InChI of 2-Aminobicyclohexyl is InChI=1S/C12H23N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h10-12H,1-9,13H2.
What is the InChIKey of 2-Aminobicyclohexyl?
The InChIKey of 2-Aminobicyclohexyl is KEHCTKVZDAEDPP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Aminobicyclohexyl?
The canonical SMILES of 2-Aminobicyclohexyl is C1CCC(CC1)C2CCCCC2N.
What is the CAS number of 2-Aminobicyclohexyl?
The CAS number of 2-Aminobicyclohexyl is 6283-14-3.
What is the XLogP3-AA of 2-Aminobicyclohexyl?
The XLogP3-AA of 2-Aminobicyclohexyl is 3.7.
How many hydrogen bond donor counts does 2-Aminobicyclohexyl have?
2-Aminobicyclohexyl has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Aminobicyclohexyl have?
2-Aminobicyclohexyl has 1 hydrogen bond acceptor count.