What is the molecular formula of 2-Amino cyclopentanol?
The molecular formula of 2-Amino cyclopentanol is C5H11NO.
What is the molecular weight of 2-Amino cyclopentanol?
The molecular weight of 2-Amino cyclopentanol is 101.15 g/mol.
What is the IUPAC name of 2-Amino cyclopentanol?
The IUPAC name of 2-Amino cyclopentanol is 2-aminocyclopentan-1-ol.
What is the InChI of 2-Amino cyclopentanol?
The InChI of 2-Amino cyclopentanol is InChI=1S/C5H11NO/c6-4-2-1-3-5(4)7/h4-5,7H,1-3,6H2.
What is the InChIKey of 2-Amino cyclopentanol?
The InChIKey of 2-Amino cyclopentanol is JFFOUICIRBXFRC-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino cyclopentanol?
The canonical SMILES of 2-Amino cyclopentanol is C1CC(C(C1)O)N.
What is the CAS number of 2-Amino cyclopentanol?
The CAS number of 2-Amino cyclopentanol is 57070-95-8.
What is the XLogP3-AA value of 2-Amino cyclopentanol?
The XLogP3-AA value of 2-Amino cyclopentanol is -0.4.
How many hydrogen bond donor counts does 2-Amino cyclopentanol have?
2-Amino cyclopentanol has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Amino cyclopentanol have?
2-Amino cyclopentanol has 2 hydrogen bond acceptor counts.