The molecular formula of the compound is C12H15NO3.
What are the synonyms of the compound?
The synonyms of the compound are: 67544-71-2 2-amino-8-methoxy-1,2,3,4-tetrahydro-naphthalene-2-carboxylic acid 2-Amino-8-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid 2-AMINO-8-METHOXY-3,4-DIHYDRO-1H-NAPHTHALENE-2-CARBOXYLIC ACID 2-Amino-8-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
What is the molecular weight of the compound?
The molecular weight of the compound is 221.25 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-amino-8-methoxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
What is the InChI key of the compound?
The InChI key of the compound is BGWOJKDTFULIKJ-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is COC1=CC=CC2=C1CC(CC2)(C(=O)O)N.
What is the CAS number of the compound?
The CAS number of the compound is 67544-71-2.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 2.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 4.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.