What is the molecular formula of 2-Amino-6-bromophenol?
The molecular formula of 2-Amino-6-bromophenol is C6H6BrNO.
What is the molecular weight of 2-Amino-6-bromophenol?
The molecular weight of 2-Amino-6-bromophenol is 188.02 g/mol.
What is the IUPAC name of 2-Amino-6-bromophenol?
The IUPAC name of 2-Amino-6-bromophenol is 2-amino-6-bromophenol.
What is the InChI of 2-Amino-6-bromophenol?
The InChI of 2-Amino-6-bromophenol is InChI=1S/C6H6BrNO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H,8H2.
What is the InChIKey of 2-Amino-6-bromophenol?
The InChIKey of 2-Amino-6-bromophenol is LOBRHADLNRMHOO-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-6-bromophenol?
The canonical SMILES of 2-Amino-6-bromophenol is C1=CC(=C(C(=C1)Br)O)N.
What is the CAS number of 2-Amino-6-bromophenol?
The CAS number of 2-Amino-6-bromophenol is 28165-50-6.
How many hydrogen bond donor counts does 2-Amino-6-bromophenol have?
2-Amino-6-bromophenol has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Amino-6-bromophenol have?
2-Amino-6-bromophenol has 2 hydrogen bond acceptor counts.