What is the molecular formula of 2-Amino-5-iodopyridine?
The molecular formula is C5H5IN2.
What is the molecular weight of 2-Amino-5-iodopyridine?
The molecular weight is 220.01 g/mol.
What is the IUPAC name of 2-Amino-5-iodopyridine?
The IUPAC name is 5-iodopyridin-2-amine.
What is the InChI of 2-Amino-5-iodopyridine?
The InChI is InChI=1S/C5H5IN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8).
What is the InChIKey of 2-Amino-5-iodopyridine?
The InChIKey is IVILGUFRMDBUEQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-5-iodopyridine?
The canonical SMILES is C1=CC(=NC=C1I)N.
What is the CAS number of 2-Amino-5-iodopyridine?
The CAS number is 20511-12-0.
What is the European Community (EC) number of 2-Amino-5-iodopyridine?
The European Community (EC) number is 626-319-0.
What is the ChEMBL ID of 2-Amino-5-iodopyridine?
The ChEMBL ID is CHEMBL1975268.
Is 2-Amino-5-iodopyridine a canonicalized compound?
Yes, 2-Amino-5-iodopyridine is a canonicalized compound according to PubChem.