2-Amino-5-chloro-4-fluorobenzoic acid

• Catalog Number: ACMA00001894
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 189.57
• Molecular Formula: C₇H₅BrFNO
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Amino-5-chloro-4-fluorobenzoic acid?

The molecular formula of 2-Amino-5-chloro-4-fluorobenzoic acid is C7H5ClFNO2.

What is the molecular weight of 2-Amino-5-chloro-4-fluorobenzoic acid?

The molecular weight of 2-Amino-5-chloro-4-fluorobenzoic acid is 189.57 g/mol.

What is the IUPAC name of 2-Amino-5-chloro-4-fluorobenzoic acid?

The IUPAC name of 2-Amino-5-chloro-4-fluorobenzoic acid is 2-amino-5-chloro-4-fluorobenzoic acid.

What is the InChIKey for 2-Amino-5-chloro-4-fluorobenzoic acid?

The InChIKey for 2-Amino-5-chloro-4-fluorobenzoic acid is VTFCXMNTJYSFIR-UHFFFAOYSA-N.

What is the Canonical SMILES for 2-Amino-5-chloro-4-fluorobenzoic acid?

The Canonical SMILES for 2-Amino-5-chloro-4-fluorobenzoic acid is C1=C(C(=CC(=C1Cl)F)N)C(=O)O.

What is the CAS number for 2-Amino-5-chloro-4-fluorobenzoic acid?

The CAS number for 2-Amino-5-chloro-4-fluorobenzoic acid is 351367-77-6.

What is the XLogP3-AA value of 2-Amino-5-chloro-4-fluorobenzoic acid?

The XLogP3-AA value of 2-Amino-5-chloro-4-fluorobenzoic acid is 2.

How many hydrogen bond donor counts are there in 2-Amino-5-chloro-4-fluorobenzoic acid?

There are 2 hydrogen bond donor counts in 2-Amino-5-chloro-4-fluorobenzoic acid.

What is the topological polar surface area of 2-Amino-5-chloro-4-fluorobenzoic acid?

The topological polar surface area of 2-Amino-5-chloro-4-fluorobenzoic acid is 63.3 A^2.

Is 2-Amino-5-chloro-4-fluorobenzoic acid a canonicalized compound?

Yes, 2-Amino-5-chloro-4-fluorobenzoic acid is a canonicalized compound.