What is the molecular formula of 2-Amino-4-bromophenol?
The molecular formula of 2-Amino-4-bromophenol is C6H6BrNO.
What is the molecular weight of 2-Amino-4-bromophenol?
The molecular weight of 2-Amino-4-bromophenol is 188.02 g/mol.
What is the IUPAC name of 2-Amino-4-bromophenol?
The IUPAC name of 2-Amino-4-bromophenol is 2-amino-4-bromophenol.
What is the InChI of 2-Amino-4-bromophenol?
The InChI of 2-Amino-4-bromophenol is InChI=1S/C6H6BrNO/c7-4-1-2-6(9)5(8)3-4/h1-3,9H,8H2.
What is the InChIKey of 2-Amino-4-bromophenol?
The InChIKey of 2-Amino-4-bromophenol is JHRIPENGTGSNPJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4-bromophenol?
The canonical SMILES of 2-Amino-4-bromophenol is C1=CC(=C(C=C1Br)N)O.
What is the CAS number of 2-Amino-4-bromophenol?
The CAS number of 2-Amino-4-bromophenol is 40925-68-6.
What is the EC number of 2-Amino-4-bromophenol?
The EC number of 2-Amino-4-bromophenol is 627-173-0.
What is the DSSTox Substance ID of 2-Amino-4-bromophenol?
The DSSTox Substance ID of 2-Amino-4-bromophenol is DTXSID00326075.
Is 2-Amino-4-bromophenol a canonicalized compound?
Yes, 2-Amino-4-bromophenol is a canonicalized compound according to PubChem.