What is the molecular formula of 2-Amino-4-bromoaniline?
The molecular formula of 2-Amino-4-bromoaniline is C6H7BrN2.
What is the molecular weight of 2-Amino-4-bromoaniline?
The molecular weight of 2-Amino-4-bromoaniline is 187.04 g/mol.
What is the IUPAC name of 2-Amino-4-bromoaniline?
The IUPAC name of 2-Amino-4-bromoaniline is 4-bromobenzene-1,2-diamine.
What is the InChI of 2-Amino-4-bromoaniline?
The InChI of 2-Amino-4-bromoaniline is InChI=1S/C6H7BrN2/c7-4-1-2-5(8)6(9)3-4/h1-3H,8-9H2.
What is the InChIKey of 2-Amino-4-bromoaniline?
The InChIKey of 2-Amino-4-bromoaniline is WIHHVKUARKTSBU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4-bromoaniline?
The canonical SMILES of 2-Amino-4-bromoaniline is C1=CC(=C(C=C1Br)N)N.
What is the CAS number of 2-Amino-4-bromoaniline?
The CAS number of 2-Amino-4-bromoaniline is 1575-37-7.
What is the European Community (EC) number of 2-Amino-4-bromoaniline?
The European Community (EC) number of 2-Amino-4-bromoaniline is 629-615-8.
What is the DSSTox Substance ID of 2-Amino-4-bromoaniline?
The DSSTox Substance ID of 2-Amino-4-bromoaniline is DTXSID80314531.
Is 2-Amino-4-bromoaniline a canonicalized compound?
Yes, 2-Amino-4-bromoaniline is a canonicalized compound.