What is the molecular formula of 2-Amino-4,6-dichloro-benzenesulfonyl chloride?
The molecular formula is C6H4Cl3NO2S.
What is the molecular weight of 2-Amino-4,6-dichloro-benzenesulfonyl chloride?
The molecular weight is 260.5 g/mol.
What is the IUPAC name of 2-Amino-4,6-dichlorobenzenesulfonyl chloride?
The IUPAC name is 2-amino-4,6-dichlorobenzenesulfonyl chloride.
What is the InChI of 2-Amino-4,6-dichlorobenzenesulfonyl chloride?
The InChI is InChI=1S/C6H4Cl3NO2S/c7-3-1-4(8)6(5(10)2-3)13(9,11)12/h1-2H,10H2.
What is the InChIKey of 2-Amino-4,6-dichlorobenzenesulfonyl chloride?
The InChIKey is RQPBYRPCEIKLIH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4,6-dichlorobenzenesulfonyl chloride?
The canonical SMILES is C1=C(C=C(C(=C1N)S(=O)(=O)Cl)Cl)Cl.
What is the XLogP3-AA value of 2-Amino-4,6-dichlorobenzenesulfonyl chloride?
The XLogP3-AA value is 3.1.
How many hydrogen bond donor counts does 2-Amino-4,6-dichlorobenzenesulfonyl chloride have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Amino-4,6-dichlorobenzenesulfonyl chloride have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Amino-4,6-dichlorobenzenesulfonyl chloride have?
It has 1 rotatable bond count.