What is the molecular formula of 2-Amino-3-bromophenol?
The molecular formula of 2-Amino-3-bromophenol is C6H6BrNO.
What is the molecular weight of 2-Amino-3-bromophenol?
The molecular weight of 2-Amino-3-bromophenol is 188.02 g/mol.
What is the IUPAC name of 2-Amino-3-bromophenol?
The IUPAC name of 2-Amino-3-bromophenol is 2-amino-3-bromophenol.
What is the InChI of 2-Amino-3-bromophenol?
The InChI of 2-Amino-3-bromophenol is InChI=1S/C6H6BrNO/c7-4-2-1-3-5(9)6(4)8/h1-3,9H,8H2.
What is the InChIKey of 2-Amino-3-bromophenol?
The InChIKey of 2-Amino-3-bromophenol is JBNSVEGZVHJLMS-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-3-bromophenol?
The canonical SMILES of 2-Amino-3-bromophenol is C1=CC(=C(C(=C1)Br)N)O.
What is the CAS number of 2-Amino-3-bromophenol?
The CAS number of 2-Amino-3-bromophenol is 116435-77-9.
What is the European Community (EC) number of 2-Amino-3-bromophenol?
The European Community (EC) number of 2-Amino-3-bromophenol is 808-390-1.
What is the DSSTox Substance ID of 2-Amino-3-bromophenol?
The DSSTox Substance ID of 2-Amino-3-bromophenol is DTXSID40617131.
Is 2-Amino-3-bromophenol a canonicalized compound?
Yes, 2-Amino-3-bromophenol is a canonicalized compound.