What is the molecular formula of 2-(Allyloxy)benzoic acid?
The molecular formula of 2-(Allyloxy)benzoic acid is C10H10O3.
What is the molecular weight of 2-(Allyloxy)benzoic acid?
The molecular weight of 2-(Allyloxy)benzoic acid is 178.18 g/mol.
What is the IUPAC name of 2-(Allyloxy)benzoic acid?
The IUPAC name of 2-(Allyloxy)benzoic acid is 2-prop-2-enoxybenzoic acid.
What is the InChI of 2-(Allyloxy)benzoic acid?
The InChI of 2-(Allyloxy)benzoic acid is InChI=1S/C10H10O3/c1-2-7-13-9-6-4-3-5-8(9)10(11)12/h2-6H,1,7H2,(H,11,12).
What is the InChIKey of 2-(Allyloxy)benzoic acid?
The InChIKey of 2-(Allyloxy)benzoic acid is XPWMIGFSEWFXEZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(Allyloxy)benzoic acid?
The canonical SMILES of 2-(Allyloxy)benzoic acid is C=CCOC1=CC=CC=C1C(=O)O.
What is the CAS number of 2-(Allyloxy)benzoic acid?
The CAS number of 2-(Allyloxy)benzoic acid is 59086-52-1.
What is the European Community (EC) number of 2-(Allyloxy)benzoic acid?
The European Community (EC) number of 2-(Allyloxy)benzoic acid is 805-094-4.
What is the XLogP3 value of 2-(Allyloxy)benzoic acid?
The XLogP3 value of 2-(Allyloxy)benzoic acid is 2.2.
Is 2-(Allyloxy)benzoic acid a formally charged compound?
No, 2-(Allyloxy)benzoic acid has a formal charge of 0.