What is the molecular formula of 2,8-Quinolinediol?
The molecular formula of 2,8-Quinolinediol is C9H7NO2.
What is the molecular weight of 2,8-Quinolinediol?
The molecular weight of 2,8-Quinolinediol is 161.16 g/mol.
What is the IUPAC name of 2,8-Quinolinediol?
The IUPAC name of 2,8-Quinolinediol is 8-hydroxy-1H-quinolin-2-one.
What is the CAS number of 2,8-Quinolinediol?
The CAS number of 2,8-Quinolinediol is 15450-76-7.
What is the InChI of 2,8-Quinolinediol?
The InChI of 2,8-Quinolinediol is InChI=1S/C9H7NO2/c11-7-3-1-2-6-4-5-8(12)10-9(6)7/h1-5,11H,(H,10,12).
What is the InChIKey of 2,8-Quinolinediol?
The InChIKey of 2,8-Quinolinediol is ZXZKYYHTWHJHFT-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,8-Quinolinediol?
The Canonical SMILES of 2,8-Quinolinediol is C1=CC2=C(C(=C1)O)NC(=O)C=C2.
What is the XLogP3-AA value of 2,8-Quinolinediol?
The XLogP3-AA value of 2,8-Quinolinediol is 1.
How many hydrogen bond donor counts does 2,8-Quinolinediol have?
2,8-Quinolinediol has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,8-Quinolinediol have?
2,8-Quinolinediol has 2 hydrogen bond acceptor counts.