What is the PubChem CID for 2,6-Diphenylaniline?
The PubChem CID for 2,6-Diphenylaniline is 11010226.
What is the molecular formula of 2,6-Diphenylaniline?
The molecular formula of 2,6-Diphenylaniline is C18H15N.
What is the molecular weight of 2,6-Diphenylaniline?
The molecular weight of 2,6-Diphenylaniline is 245.3 g/mol.
What is the IUPAC name of 2,6-Diphenylaniline?
The IUPAC name of 2,6-Diphenylaniline is 2,6-diphenylaniline.
What is the InChI of 2,6-Diphenylaniline?
The InChI of 2,6-Diphenylaniline is InChI=1S/C18H15N/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13H,19H2.
What is the InChIKey of 2,6-Diphenylaniline?
The InChIKey of 2,6-Diphenylaniline is DSQMLISBVUTWJB-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Diphenylaniline?
The canonical SMILES of 2,6-Diphenylaniline is C1=CC=C(C=C1)C2=C(C(=CC=C2)C3=CC=CC=C3)N.
What is the CAS number of 2,6-Diphenylaniline?
The CAS number of 2,6-Diphenylaniline is 87666-57-7.
What is the European Community (EC) Number of 2,6-Diphenylaniline?
The European Community (EC) Number of 2,6-Diphenylaniline is 804-369-6.
Is 2,6-Diphenylaniline a canonicalized compound?
Yes, 2,6-Diphenylaniline is a canonicalized compound according to PubChem.