What is the molecular formula of 2,6-Dimethyl-2,4,6-octatriene?
The molecular formula of 2,6-Dimethyl-2,4,6-octatriene is C10H16.
What is the molecular weight of 2,6-Dimethyl-2,4,6-octatriene?
The molecular weight of 2,6-Dimethyl-2,4,6-octatriene is 136.23 g/mol.
What is the IUPAC Name of 2,6-Dimethyl-2,4,6-octatriene?
The IUPAC Name of 2,6-Dimethyl-2,4,6-octatriene is (4E,6E)-2,6-dimethylocta-2,4,6-triene.
What is the InChI of 2,6-Dimethyl-2,4,6-octatriene?
The InChI of 2,6-Dimethyl-2,4,6-octatriene is InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5-8H,1-4H3/b8-6+,10-5+.
What is the InChIKey of 2,6-Dimethyl-2,4,6-octatriene?
The InChIKey of 2,6-Dimethyl-2,4,6-octatriene is GQVMHMFBVWSSPF-SOYUKNQTSA-N.
What is the Canonical SMILES of 2,6-Dimethyl-2,4,6-octatriene?
The Canonical SMILES of 2,6-Dimethyl-2,4,6-octatriene is CC=C(C)C=CC=C(C)C.
Is 2,6-Dimethyl-2,4,6-octatriene a natural product?
Yes, 2,6-Dimethyl-2,4,6-octatriene is a natural product found in Curcuma amada, Psidium guajava, and other organisms.
What is the CAS number of 2,6-Dimethyl-2,4,6-octatriene?
The CAS number of 2,6-Dimethyl-2,4,6-octatriene is 3016-19-1.
What is the molecular weight of 2,6-Dimethyl-2,4,6-octatriene according to PubChem?
The computed molecular weight of 2,6-Dimethyl-2,4,6-octatriene according to PubChem is 136.23 g/mol.
How many rotatable bonds does 2,6-Dimethyl-2,4,6-octatriene have?
2,6-Dimethyl-2,4,6-octatriene has 2 rotatable bonds.