What is the molecular formula of 2,6-Difluoropyridine?
The molecular formula of 2,6-Difluoropyridine is C5H3F2N.
What is the molecular weight of 2,6-Difluoropyridine?
The molecular weight of 2,6-Difluoropyridine is 115.08 g/mol.
What is the IUPAC name of 2,6-Difluoropyridine?
The IUPAC name of 2,6-Difluoropyridine is 2,6-difluoropyridine.
What is the InChI of 2,6-Difluoropyridine?
The InChI of 2,6-Difluoropyridine is InChI=1S/C5H3F2N/c6-4-2-1-3-5(7)8-4/h1-3H.
What is the InChIKey of 2,6-Difluoropyridine?
The InChIKey of 2,6-Difluoropyridine is MBTGBRYMJKYYOE-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Difluoropyridine?
The canonical SMILES of 2,6-Difluoropyridine is C1=CC(=NC(=C1)F)F.
What is the CAS number of 2,6-Difluoropyridine?
The CAS number of 2,6-Difluoropyridine is 1513-65-1.
What is the European Community (EC) number of 2,6-Difluoropyridine?
The European Community (EC) number of 2,6-Difluoropyridine is 216-152-8.
What is the ChEMBL ID of 2,6-Difluoropyridine?
The ChEMBL ID of 2,6-Difluoropyridine is CHEMBL449478.
Does 2,6-Difluoropyridine have any hydrogen bond donor count?
No, 2,6-Difluoropyridine does not have any hydrogen bond donor count (0).