What is the molecular formula of 2,6-Difluorobenzoic acid?
The molecular formula of 2,6-Difluorobenzoic acid is C7H4F2O2.
What is the molecular weight of 2,6-Difluorobenzoic acid?
The molecular weight of 2,6-Difluorobenzoic acid is 158.10 g/mol.
What is the IUPAC name of 2,6-Difluorobenzoic acid?
The IUPAC name of 2,6-Difluorobenzoic acid is 2,6-difluorobenzoic acid.
What is the InChI of 2,6-Difluorobenzoic acid?
The InChI of 2,6-Difluorobenzoic acid is InChI=1S/C7H4F2O2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11).
What is the InChIKey of 2,6-Difluorobenzoic acid?
The InChIKey of 2,6-Difluorobenzoic acid is ONOTYLMNTZNAQZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Difluorobenzoic acid?
The canonical SMILES of 2,6-Difluorobenzoic acid is C1=CC(=C(C(=C1)F)C(=O)O)F.
What is the CAS number of 2,6-Difluorobenzoic acid?
The CAS number of 2,6-Difluorobenzoic acid is 385-00-2.
How many hydrogen bond donor counts does 2,6-Difluorobenzoic acid have?
2,6-Difluorobenzoic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2,6-Difluorobenzoic acid have?
2,6-Difluorobenzoic acid has 4 hydrogen bond acceptor counts.